|
CAS#: 117153-91-0 Product: gamma-Poly-alpha,gamma-Diaminobutyric Acid No suppilers available for the product. |
| Name | gamma-Poly-alpha,gamma-Diaminobutyric Acid |
|---|---|
| Synonyms | 2-Amino-4-(2,4-Diaminobutanoylamino)-1-Hydroxy-Butan-1-Olate; 2-Amino-4-[(2,4-Diamino-1-Oxobutyl)Amino]-1-Hydroxybutan-1-Olate; Poly(Imino(2-Amino-1-Oxo-1,4-Butanediyl)), (S)- |
| Molecular Formula | C8H19N4O3 |
| Molecular Weight | 219.26 |
| CAS Registry Number | 117153-91-0 |
| SMILES | C(N)CC(N)C(=O)NCCC(N)C(O)[O-] |
| InChI | 1S/C8H19N4O3/c9-3-1-5(10)7(13)12-4-2-6(11)8(14)15/h5-6,8,14H,1-4,9-11H2,(H,12,13)/q-1 |
| InChIKey | CXSQFTMIJNQLFQ-UHFFFAOYSA-N |
| Boiling point | 567.555°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 297.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for gamma-Poly-alpha,gamma-Diaminobutyric Acid |