|
CAS#: 1179-87-9 Product: 16-alpha,17-Dihydroxy-alpha-methylbenzylidenedioxyprogesterone No suppilers available for the product. |
| Name | 16-alpha,17-Dihydroxy-alpha-methylbenzylidenedioxyprogesterone |
|---|---|
| Synonyms | 16Alpha,17Alpha-Dihydroxyprogesterone Acetophenonide; Nsc 68280; Pregn-4-Ene-3,20-Dione, 16Alpha,17-Dihydroxy-, Cyclic Acetal With Acetophenone (8Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 |
| CAS Registry Number | 1179-87-9 |
| EINECS | 214-649-4 |
| SMILES | [C@@]45([C@@]3([C@H]([C@H]2[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)CC3)C[C@H]4OC(O5)(C6=CC=CC=C6)C)C)C(C)=O |
| InChI | 1S/C29H36O4/c1-18(30)29-25(32-28(4,33-29)19-8-6-5-7-9-19)17-24-22-11-10-20-16-21(31)12-14-26(20,2)23(22)13-15-27(24,29)3/h5-9,16,22-25H,10-15,17H2,1-4H3/t22-,23+,24+,25-,26+,27+,28?,29-/m1/s1 |
| InChIKey | AHBKIEXBQNRDNL-BXXPAUNWSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.008°C at 760 mmHg (Cal.) |
| Flash point | 246.693°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-alpha,17-Dihydroxy-alpha-methylbenzylidenedioxyprogesterone |