|
CAS#: 121-06-2 Product: Tris(2,6-Dimethylphenyl) Phosphate No suppilers available for the product. |
| Name | Tris(2,6-Dimethylphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Tris(2,6-Dimethylphenyl) Ester; 2,6-Xylenol, Phosphate (3:1); 2,6-Xylyl Phosphate, (C8h9o)3Po |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.45 |
| CAS Registry Number | 121-06-2 |
| SMILES | C1=C(C(=C(C=C1)C)O[P](OC2=C(C=CC=C2C)C)(OC3=C(C=CC=C3C)C)=O)C |
| InChI | 1S/C24H27O4P/c1-16-10-7-11-17(2)22(16)26-29(25,27-23-18(3)12-8-13-19(23)4)28-24-20(5)14-9-15-21(24)6/h7-15H,1-6H3 |
| InChIKey | QLORRTLBSJTMSN-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.895°C at 760 mmHg (Cal.) |
| Flash point | 229.58°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tris(2,6-Dimethylphenyl) Phosphate |