|
CAS#: 1217-37-4 Product: 1-(5-Oxophenothiazin-10-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(5-Oxophenothiazin-10-Yl)Ethanone |
|---|---|
| Synonyms | 1-(5-Oxo-10-Phenothiazinyl)Ethanone; 1-(5-Ketophenothiazin-10-Yl)Ethanone; Nsc1933 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 |
| CAS Registry Number | 1217-37-4 |
| SMILES | C1=CC=CC2=C1[S](=O)C3=C(N2C(=O)C)C=CC=C3 |
| InChI | 1S/C14H11NO2S/c1-10(16)15-11-6-2-4-8-13(11)18(17)14-9-5-3-7-12(14)15/h2-9H,1H3 |
| InChIKey | SZLYHEJOJMRRFR-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.006°C at 760 mmHg (Cal.) |
| Flash point | 287.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(5-Oxophenothiazin-10-Yl)Ethanone |