|
CAS#: 125421-22-9 Product: 2-[(2-Aminophenyl)Carbamothioylamino]Acetic Acid No suppilers available for the product. |
| Name | 2-[(2-Aminophenyl)Carbamothioylamino]Acetic Acid |
|---|---|
| Synonyms | 2-[[[(2-Aminophenyl)Amino]-Thioxomethyl]Amino]Acetic Acid; 2-[(2-Aminophenyl)Thiocarbamoylamino]Acetic Acid; 2-[(2-Aminophenyl)Carbamothioylamino]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.26 |
| CAS Registry Number | 125421-22-9 |
| SMILES | C1=C(NC(=S)NCC(=O)O)C(=CC=C1)N |
| InChI | 1S/C9H11N3O2S/c10-6-3-1-2-4-7(6)12-9(15)11-5-8(13)14/h1-4H,5,10H2,(H,13,14)(H2,11,12,15) |
| InChIKey | CZGCMOFGLOQOBE-UHFFFAOYSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.932°C at 760 mmHg (Cal.) |
| Flash point | 214.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Aminophenyl)Carbamothioylamino]Acetic Acid |