|
CAS#: 128110-33-8 Product: Dexylosylbenanomicin B No suppilers available for the product. |
| Name | Dexylosylbenanomicin B |
|---|---|
| Synonyms | Desxylosyl-Benanomicin B |
| Molecular Structure | ![]() |
| Molecular Formula | C34H34N2O14 |
| Molecular Weight | 694.65 |
| CAS Registry Number | 128110-33-8 |
| SMILES | [C@H]3(O[C@@H]1O[C@@H]([C@H](N)[C@H](O)[C@H]1O)C)C2=CC(=C(C(=C2C4=C([C@@H]3O)C=C5C(=C4O)C(=O)C6=C(C5=O)C(=CC(=C6)OC)O)O)C(=O)N[C@@H](C(=O)O)C)C |
| InChI | 1S/C34H34N2O14/c1-9-5-16-21(27(41)18(9)32(45)36-10(2)33(46)47)20-14(26(40)31(16)50-34-30(44)29(43)23(35)11(3)49-34)8-15-22(28(20)42)25(39)13-6-12(48-4)7-17(37)19(13)24(15)38/h5-8,10-11,23,26,29-31,34,37,40-44H,35H2,1-4H3,(H,36,45)(H,46,47)/t10-,11-,23+,26+,29+,30-,31+,34+/m1/s1 |
| InChIKey | RLAZQZRIYCOWMY-JAULALIESA-N |
| Density | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 1018.206°C at 760 mmHg (Cal.) |
| Flash point | 569.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dexylosylbenanomicin B |