|
CAS#: 128753-87-7 Product: 2a,7b-Dihydro-7-Methoxy-2a,7b-Dimethyl-1,2-Dioxeto(3,4-b)Benzofuran No suppilers available for the product. |
| Name | 2a,7b-Dihydro-7-Methoxy-2a,7b-Dimethyl-1,2-Dioxeto(3,4-b)Benzofuran |
|---|---|
| Synonyms | Ccris 4154 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 128753-87-7 |
| SMILES | C2=CC=C1OC3(C(C1=C2OC)(OO3)C)C |
| InChI | 1S/C11H12O4/c1-10-9-7(12-3)5-4-6-8(9)13-11(10,2)15-14-10/h4-6H,1-3H3 |
| InChIKey | AMBRBRILSDZRQV-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.765°C at 760 mmHg (Cal.) |
| Flash point | 107.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2a,7b-Dihydro-7-Methoxy-2a,7b-Dimethyl-1,2-Dioxeto(3,4-b)Benzofuran |