|
CAS#: 132194-83-3 Product: 1,3-Dichloro-8-Iodo-6-Methyldibenzofuran No suppilers available for the product. |
| Name | 1,3-Dichloro-8-Iodo-6-Methyldibenzofuran |
|---|---|
| Synonyms | 1,3-Dichloro-8-Iodo-6-Methyl-Dibenzofuran; 6-Methyl-8-Iodo-1,3-Dichlordibenzofuran; Dibenzofuran, 1,3-Dichloro-8-Iodo-6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7Cl2IO |
| Molecular Weight | 377.01 |
| CAS Registry Number | 132194-83-3 |
| SMILES | C1=C(C=C2C(=C1C)OC3=C2C(=CC(=C3)Cl)Cl)I |
| InChI | 1S/C13H7Cl2IO/c1-6-2-8(16)5-9-12-10(15)3-7(14)4-11(12)17-13(6)9/h2-5H,1H3 |
| InChIKey | OBPNDBUBANGTHF-UHFFFAOYSA-N |
| Density | 1.86g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.277°C at 760 mmHg (Cal.) |
| Flash point | 219.467°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-8-Iodo-6-Methyldibenzofuran |