|
CAS#: 132210-43-6 Product: 8-Amino-1,3-Bis(Cyclopropylmethyl)-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 8-Amino-1,3-Bis(Cyclopropylmethyl)-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-Amino-1,3-Bis(Cyclopropylmethyl)-7H-Purine-2,6-Quinone; Cipamfylline (Usan); D03516 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 |
| CAS Registry Number | 132210-43-6 |
| SMILES | C(N1C3=C(C(=O)N(C1=O)CC2CC2)[NH]C(=N3)N)C4CC4 |
| InChI | 1S/C13H17N5O2/c14-12-15-9-10(16-12)17(5-7-1-2-7)13(20)18(11(9)19)6-8-3-4-8/h7-8H,1-6H2,(H3,14,15,16) |
| InChIKey | KSPYMJJKQMWWNB-UHFFFAOYSA-N |
| Density | 1.539g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.172°C at 760 mmHg (Cal.) |
| Flash point | 289.558°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 8-Amino-1,3-Bis(Cyclopropylmethyl)-7H-Purine-2,6-Dione |