|
CAS#: 135743-11-2 Product: (1R)-2,2,4-Trimethyl-3-(3-oxobutyl)-3-cyclohexen-1-yl beta-D-glucopyranoside No suppilers available for the product. |
| Name | (1R)-2,2,4-Trimethyl-3-(3-oxobutyl)-3-cyclohexen-1-yl beta-D-glucopyranoside |
|---|---|
| Synonyms | Icariside B9 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.45 |
| CAS Registry Number | 135743-11-2 |
| SMILES | CC(=O)CC\C2=C(/C)CC[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@]2(C)C |
| InChI | 1S/C19H32O7/c1-10-5-8-14(19(3,4)12(10)7-6-11(2)21)26-18-17(24)16(23)15(22)13(9-20)25-18/h13-18,20,22-24H,5-9H2,1-4H3/t13-,14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | PCUDAQRRXUJHQH-OBRKIGFESA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.399°C at 760 mmHg (Cal.) |
| Flash point | 186.278°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R)-2,2,4-Trimethyl-3-(3-oxobutyl)-3-cyclohexen-1-yl beta-D-glucopyranoside |