|
CAS#: 13657-24-4 Product: 1-(3,3-Diphenylpropyl)Hexahydro-1H-Azepinium Chloride No suppilers available for the product. |
| Name | 1-(3,3-Diphenylpropyl)Hexahydro-1H-Azepinium Chloride |
|---|---|
| Synonyms | 1-(3,3-Diphenylpropyl)Hexahydro-1H-Azepinium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28ClN |
| Molecular Weight | 329.91 |
| CAS Registry Number | 13657-24-4 |
| EINECS | 237-143-5 |
| SMILES | [H+].C3=C(C(C1=CC=CC=C1)CCN2CCCCCC2)C=CC=C3.[Cl-] |
| InChI | 1S/C21H27N.ClH/c1-2-10-17-22(16-9-1)18-15-21(19-11-5-3-6-12-19)20-13-7-4-8-14-20;/h3-8,11-14,21H,1-2,9-10,15-18H2;1H |
| InChIKey | FQPKTVQUKHWXFF-UHFFFAOYSA-N |
| Boiling point | 428.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 188.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,3-Diphenylpropyl)Hexahydro-1H-Azepinium Chloride |