|
CAS#: 136577-07-6 Product: (2R)-2-[(2R)-2-Aminopropanoyl]Oxypropanoic Acid No suppilers available for the product. |
| Name | (2R)-2-[(2R)-2-Aminopropanoyl]Oxypropanoic Acid |
|---|---|
| Synonyms | (2R)-2-[(2R)-2-Amino-1-Oxopropoxy]Propanoic Acid; (2R)-2-Alanyloxypropionic Acid; Alanyl-Lactate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 136577-07-6 |
| SMILES | [C@H](OC(=O)[C@H](N)C)(C(=O)O)C |
| InChI | 1S/C6H11NO4/c1-3(7)6(10)11-4(2)5(8)9/h3-4H,7H2,1-2H3,(H,8,9)/t3-,4-/m1/s1 |
| InChIKey | QLYOONKPELZQGZ-QWWZWVQMSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.096°C at 760 mmHg (Cal.) |
| Flash point | 123.198°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-[(2R)-2-Aminopropanoyl]Oxypropanoic Acid |