|
CAS#: 14124-56-2 Product: 2,3-Secocholestane-2,3-Diol No suppilers available for the product. |
| Name | 2,3-Secocholestane-2,3-Diol |
|---|---|
| Synonyms | 2-[(3R,3Ar,5As,6S,7S,9Ar,9Bs)-3-[(1R)-1,5-Dimethylhexyl]-7-(2-Hydroxyethyl)-3A,6-Dimethyl-2,3,4,5,5A,7,8,9,9A,9B-Decahydro-1H-Cyclopenta[F]Naphthalen-6-Yl]Ethanol; 2,3-Scd; 2,3-Secocholestane-2,3-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C27H50O2 |
| Molecular Weight | 406.69 |
| CAS Registry Number | 14124-56-2 |
| SMILES | [C@@H]3([C@@H](CCCC(C)C)C)[C@@]2([C@H]([C@@H]1CC[C@@H](CCO)[C@](CCO)([C@H]1CC2)C)CC3)C |
| InChI | 1S/C27H50O2/c1-19(2)7-6-8-20(3)23-11-12-24-22-10-9-21(14-17-28)26(4,16-18-29)25(22)13-15-27(23,24)5/h19-25,28-29H,6-18H2,1-5H3/t20-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | MYDRWTVVYQCTQX-CJPSHIORSA-N |
| Density | 0.944g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.766°C at 760 mmHg (Cal.) |
| Flash point | 203.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Secocholestane-2,3-Diol |