|
CAS#: 141263-54-9 Product: [(2R,4R)-6-(2,4-Dichlorophenyl)-2,4-Dihydroxyhexyl]Phosphonic Acid No suppilers available for the product. |
| Name | [(2R,4R)-6-(2,4-Dichlorophenyl)-2,4-Dihydroxyhexyl]Phosphonic Acid |
|---|---|
| Synonyms | [(2R,4R)-6-(2,4-Dichlorophenyl)-2,4-Dihydroxy-Hexyl]Phosphonic Acid; 6-(2,4-Dichlorophenyl)-Erythro-2,4-Dihydroxyhexylphosphonic Acid; Dcphhp |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17Cl2O5P |
| Molecular Weight | 343.14 |
| CAS Registry Number | 141263-54-9 |
| SMILES | [C@H](C[P](=O)(O)O)(C[C@@H](CCC1=CC=C(C=C1Cl)Cl)O)O |
| InChI | 1S/C12H17Cl2O5P/c13-9-3-1-8(12(14)5-9)2-4-10(15)6-11(16)7-20(17,18)19/h1,3,5,10-11,15-16H,2,4,6-7H2,(H2,17,18,19)/t10-,11-/m1/s1 |
| InChIKey | GGAVPGOIUVCRHG-GHMZBOCLSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.277°C at 760 mmHg (Cal.) |
| Flash point | 313.813°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(2R,4R)-6-(2,4-Dichlorophenyl)-2,4-Dihydroxyhexyl]Phosphonic Acid |