|
CAS#: 14225-98-0 Product: 6-(Bromomethyl)-9H-Purine No suppilers available for the product. |
| Name | 6-(Bromomethyl)-9H-Purine |
|---|---|
| Synonyms | 6-(Bromomethyl)-9H-Purine; 6-Bmpu; 1H-Purine, 6-(Bromomethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5BrN4 |
| Molecular Weight | 213.04 |
| CAS Registry Number | 14225-98-0 |
| SMILES | C2=NC1=NC=NC(=C1[NH]2)CBr |
| InChI | 1S/C6H5BrN4/c7-1-4-5-6(10-2-8-4)11-3-9-5/h2-3H,1H2,(H,8,9,10,11) |
| InChIKey | KJRSLPCFTVMQGY-UHFFFAOYSA-N |
| Density | 1.919g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.276°C at 760 mmHg (Cal.) |
| Flash point | 242.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Bromomethyl)-9H-Purine |