|
CAS#: 1506-15-6 Product: 1,2,3,4,5,6-hexachloro-7-methoxy-naphthalene No suppilers available for the product. |
| Name | 1,2,3,4,5,6-hexachloro-7-methoxy-naphthalene |
|---|---|
| Synonyms | 1,2,3,4,5,6-Hexachloro-7-Methoxy-Naphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H4Cl6O |
| Molecular Weight | 364.87 |
| CAS Registry Number | 1506-15-6 |
| EINECS | 216-135-5 |
| SMILES | C1=C(OC)C(=C(C2=C(C(=C(C(=C12)Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C11H4Cl6O/c1-18-4-2-3-5(8(14)7(4)13)9(15)11(17)10(16)6(3)12/h2H,1H3 |
| InChIKey | NGFRBDQAKZEZJX-UHFFFAOYSA-N |
| Density | 1.664g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.844°C at 760 mmHg (Cal.) |
| Flash point | 161.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,6-hexachloro-7-methoxy-naphthalene |