|
CAS#: 151656-58-5 Product: 4-(3-Thienyl)-alpha,alpha,1-trimethyl-4-piperidinemethanol hemifumarate salt No suppilers available for the product. |
| Name | 4-(3-Thienyl)-alpha,alpha,1-trimethyl-4-piperidinemethanol hemifumarate salt |
|---|---|
| Synonyms | But-2-Enedioic Acid; 2-[1-Methyl-4-(3-Thienyl)-4-Piperidyl]Propan-2-Ol; But-2-Enedioic Acid; 2-[1-Methyl-4-(3-Thienyl)-4-Piperidinyl]Propan-2-Ol; But-2-Enedioic Acid; 2-(1-Methyl-4-Thiophen-3-Yl-Piperidin-4-Yl)Propan-2-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.45 |
| CAS Registry Number | 151656-58-5 |
| SMILES | C2=C(C1(C(O)(C)C)CCN(CC1)C)C=CS2.O=C(O)\C=C/C(=O)O |
| InChI | 1S/C13H21NOS.C4H4O4/c1-12(2,15)13(11-4-9-16-10-11)5-7-14(3)8-6-13;5-3(6)1-2-4(7)8/h4,9-10,15H,5-8H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | UPIVEKIRCYVMLE-BTJKTKAUSA-N |
| Boiling point | 337.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 157.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Thienyl)-alpha,alpha,1-trimethyl-4-piperidinemethanol hemifumarate salt |