|
CAS#: 156312-09-3 Product: 7-Chloro-9-Methylpyrido[3,4-b]Indole No suppilers available for the product. |
| Name | 7-Chloro-9-Methylpyrido[3,4-b]Indole |
|---|---|
| Synonyms | 7-Chloro-9-Methyl-Pyrido[3,4-B]Indole; 7-Chloro-9-Methyl-$B-Carboline; 7-Chloro-9-Methyl-9H-Pyrido(3,4-B)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.67 |
| CAS Registry Number | 156312-09-3 |
| SMILES | C1=CC(=CC3=C1C2=CC=NC=C2[N]3C)Cl |
| InChI | 1S/C12H9ClN2/c1-15-11-6-8(13)2-3-9(11)10-4-5-14-7-12(10)15/h2-7H,1H3 |
| InChIKey | CRAMILMCKLDURA-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.325°C at 760 mmHg (Cal.) |
| Flash point | 195.305°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-9-Methylpyrido[3,4-b]Indole |