|
CAS#: 16053-68-2 Product: Protoporphyrin Ix Monomethyl Ester No suppilers available for the product. |
| Name | Protoporphyrin Ix Monomethyl Ester |
|---|---|
| Synonyms | Magnesium Protoporphyrin Ix Monomethyl Ester; Mg-Protoporphyrin Ix Monomethyl Ester; Mgprotome |
| Molecular Structure | ![]() |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.69 |
| CAS Registry Number | 16053-68-2 |
| SMILES | C(C1=C(C3=NC1=CC5=NC(=CC2=C(C(=C([NH]2)C=C4[NH]C(=C3)C(=C4C)C=C)C=C)C)C(=C5CCC(O)=O)C)C)CC(OC)=O |
| InChI | 1S/C35H36N4O4/c1-8-22-18(3)26-14-27-20(5)24(10-12-34(40)41)32(38-27)17-33-25(11-13-35(42)43-7)21(6)29(39-33)16-31-23(9-2)19(4)28(37-31)15-30(22)36-26/h8-9,14-17,36-37H,1-2,10-13H2,3-7H3,(H,40,41) |
| InChIKey | QFOYLAGRMXUVSR-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 1073.514°C at 760 mmHg (Cal.) |
| Flash point | 603.04°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Protoporphyrin Ix Monomethyl Ester |