Online Database of Chemicals from Around the World
|
CAS#: 160543-08-8 Product: (7-Methylnaphtho[1,2-b]Quinolin-10-Yl)Methanol No suppilers available for the product. |
| Name | (7-Methylnaphtho[1,2-b]Quinolin-10-Yl)Methanol |
|---|---|
| Synonyms | (7-Methyl-10-Naphtho[1,2-B]Quinolinyl)Methanol; 10-Hydroxymethyl-7-Methylbenz(C)Acridine; Ccris 7381 |
| Molecular Structure | ![CAS#: 160543-08-8, (7-Methylnaphtho[1,2-b]Quinolin-10-Yl)Methanol](/moreStructures/160543-08-8.gif) |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 |
| CAS Registry Number | 160543-08-8 |
| SMILES | C3=CC1=CC=CC=C1C4=NC2=CC(=CC=C2C(=C34)C)CO |
| InChI | 1S/C19H15NO/c1-12-15-8-6-13(11-21)10-18(15)20-19-16(12)9-7-14-4-2-3-5-17(14)19/h2-10,21H,11H2,1H3 |
| InChIKey | RFUAMQCKKXWCFF-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.372°C at 760 mmHg (Cal.) |
| Flash point | 276.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (7-Methylnaphtho[1,2-b]Quinolin-10-Yl)Methanol |