|
CAS#: 16377-00-7 Product: Indospicine No suppilers available for the product. |
| Name | Indospicine |
|---|---|
| Synonyms | (2S)-2,7-Diamino-7-Imino-Heptanoic Acid; (2S)-2,7-Diamino-7-Imino-Enanthic Acid; L-Indospicine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.21 |
| CAS Registry Number | 16377-00-7 |
| SMILES | [C@@H](N)(C(=O)O)CCCCC(=N)N |
| InChI | 1S/C7H15N3O2/c8-5(7(11)12)3-1-2-4-6(9)10/h5H,1-4,8H2,(H3,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | SILQDLDAWPQMEL-YFKPBYRVSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.1±52.0°C at 760 mmHg (Cal.) |
| Flash point | 165.5±30.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indospicine |