|
CAS#: 16409-92-0 Product: Erythrulose 1-Phosphate No suppilers available for the product. |
| Name | Erythrulose 1-Phosphate |
|---|---|
| Synonyms | [(3S)-3,4-Dihydroxy-2-Oxo-Butyl] Dihydrogen Phosphate; [(3S)-3,4-Dihydroxy-2-Keto-Butyl] Dihydrogen Phosphate; (3S)-3,4-Dihydroxy-2-Oxobutyl Dihydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9O7P |
| Molecular Weight | 200.08 |
| CAS Registry Number | 16409-92-0 |
| SMILES | [C@@H](O)(C(=O)CO[P](O)(O)=O)CO |
| InChI | 1S/C4H9O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h3,5-6H,1-2H2,(H2,8,9,10)/t3-/m0/s1 |
| InChIKey | TZCZUVPSFJZERP-VKHMYHEASA-N |
| Density | 1.777g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.124°C at 760 mmHg (Cal.) |
| Flash point | 267.757°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Erythrulose 1-Phosphate |