|
CAS#: 16527-81-4 Product: Zinc Ethyl Phosphate No suppilers available for the product. |
| Name | Zinc Ethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid, Monoethyl Ester, Zinc Salt (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C2H5O4PZn |
| Molecular Weight | 189.41 |
| CAS Registry Number | 16527-81-4 |
| EINECS | 240-593-5 |
| SMILES | C(O[P]([O-])([O-])=O)C.[Zn++] |
| InChI | 1S/C2H7O4P.Zn/c1-2-6-7(3,4)5;/h2H2,1H3,(H2,3,4,5);/q;+2/p-2 |
| InChIKey | UACZWEHNJDEXJP-UHFFFAOYSA-L |
| Boiling point | 252.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 106.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc Ethyl Phosphate |