|
CAS#: 167105-92-2 Product: 6,8-Dihydroxy-5,7-Dimethoxychromen-2-One No suppilers available for the product. |
| Name | 6,8-Dihydroxy-5,7-Dimethoxychromen-2-One |
|---|---|
| Synonyms | 6,8-Dihydroxy-5,7-Dimethoxy-Chromen-2-One; 6,8-Dihydroxy-5,7-Dimethoxy-2-Chromenone; 6,8-Dihydroxy-5,7-Dimethoxy-Coumarin |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.20 |
| CAS Registry Number | 167105-92-2 |
| SMILES | COC1=C(O)C(=C2C(=C1O)OC(C=C2)=O)OC |
| InChI | 1S/C11H10O6/c1-15-9-5-3-4-6(12)17-10(5)8(14)11(16-2)7(9)13/h3-4,13-14H,1-2H3 |
| InChIKey | AXXSKWGVOIJTGN-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.311°C at 760 mmHg (Cal.) |
| Flash point | 209.368°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dihydroxy-5,7-Dimethoxychromen-2-One |