|
CAS#: 16712-79-1 Product: 3-Hydroxyasparagine No suppilers available for the product. |
| Name | 3-Hydroxyasparagine |
|---|---|
| Synonyms | (2S)-2,4-Diamino-3-Hydroxy-4-Oxo-Butanoic Acid; (2S)-2,4-Diamino-3-Hydroxy-4-Keto-Butyric Acid; 3-Hydroxyasparagine |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8N2O4 |
| Molecular Weight | 148.12 |
| CAS Registry Number | 16712-79-1 |
| SMILES | [C@H](C(=O)O)(N)C(C(=O)N)O |
| InChI | 1S/C4H8N2O4/c5-1(4(9)10)2(7)3(6)8/h1-2,7H,5H2,(H2,6,8)(H,9,10)/t1-,2?/m0/s1 |
| InChIKey | VQTLPSCRBFYDNX-PIKHSQJKSA-N |
| Density | 1.611g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.091°C at 760 mmHg (Cal.) |
| Flash point | 262.294°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxyasparagine |