Online Database of Chemicals from Around the World
|
CAS#: 16720-03-9 Product: 7,8,9,10-Tetrahydro-6,6-Dimethyl-6H-Dibenzo[b,d]Pyran-1,3-Diol No suppilers available for the product. |
| Name | 7,8,9,10-Tetrahydro-6,6-Dimethyl-6H-Dibenzo[b,d]Pyran-1,3-Diol |
|---|---|
| Synonyms | 6,6-Dimethyl-7,8,9,10-Tetrahydro-6H-Dibenzo(B,D)Pyran-1,3-Diol; 6H-Dibenzo(B,D)Pyran-1,3-Diol, 6,6-Dimethyl-7,8,9,10-Tetrahydro- |
| Molecular Structure | ![CAS#: 16720-03-9, 7,8,9,10-Tetrahydro-6,6-Dimethyl-6H-Dibenzo[b,d]Pyran-1,3-Diol](/moreStructures/16720-03-9.gif) |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 |
| CAS Registry Number | 16720-03-9 |
| SMILES | C1=C(O)C=C(O)C2=C1OC(C3=C2CCCC3)(C)C |
| InChI | 1S/C15H18O3/c1-15(2)11-6-4-3-5-10(11)14-12(17)7-9(16)8-13(14)18-15/h7-8,16-17H,3-6H2,1-2H3 |
| InChIKey | INDSXFNQCMKBOI-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.201°C at 760 mmHg (Cal.) |
| Flash point | 227.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,10-Tetrahydro-6,6-Dimethyl-6H-Dibenzo[b,d]Pyran-1,3-Diol |