Online Database of Chemicals from Around the World
|
CAS#: 16757-88-3 Product: 1,4-Dimethylbenzo[a]Pyrene No suppilers available for the product. |
| Name | 1,4-Dimethylbenzo[a]Pyrene |
|---|---|
| Synonyms | 1,4-Dimethylbenzo(A)Pyrene; Benzo(A)Pyrene, 1,4-Dimethyl-; Brn 3303910 |
| Molecular Structure | ![CAS#: 16757-88-3, 1,4-Dimethylbenzo[a]Pyrene](/moreStructures/16757-88-3.gif) |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 16757-88-3 |
| SMILES | C1=CC4=C3C2=C1C5=C(C=C2C=C(C3=CC=C4C)C)C=CC=C5 |
| InChI | 1S/C22H16/c1-13-7-8-18-14(2)11-16-12-15-5-3-4-6-19(15)20-10-9-17(13)22(18)21(16)20/h3-12H,1-2H3 |
| InChIKey | COUWIODFWWMEFK-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.467°C at 760 mmHg (Cal.) |
| Flash point | 245.015°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dimethylbenzo[a]Pyrene |