|
CAS#: 17283-45-3 Product: 1,7,7-Trimethyl-Exo-(+-)-Bicyclo[2.2.1]Heptan-2-Ol Acetate No suppilers available for the product. |
| Name | 1,7,7-Trimethyl-Exo-(+-)-Bicyclo[2.2.1]Heptan-2-Ol Acetate |
|---|---|
| Synonyms | [(1R,2R,4S)-1,7,7-Trimethylnorbornan-2-Yl] Acetate; Acetic Acid [(1R,2R,4S)-1,7,7-Trimethyl-2-Norbornanyl] Ester; [(1R,4S,6R)-1,7,7-Trimethyl-6-Bicyclo[2.2.1]Heptanyl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 17283-45-3 |
| SMILES | [C@@]12([C@@H](C[C@@H](C1(C)C)CC2)OC(C)=O)C |
| InChI | 1S/C12H20O2/c1-8(13)14-10-7-9-5-6-12(10,4)11(9,2)3/h9-10H,5-7H2,1-4H3/t9-,10+,12-/m0/s1 |
| InChIKey | KGEKLUUHTZCSIP-UMNHJUIQSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 223.499°C at 760 mmHg (Cal.) |
| Flash point | 84.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7,7-Trimethyl-Exo-(+-)-Bicyclo[2.2.1]Heptan-2-Ol Acetate |