|
CAS#: 17302-70-4 Product: 1-(4-Butyrylphenyl)-2-(4-Nitrophenyl)Ethane No suppilers available for the product. |
| Name | 1-(4-Butyrylphenyl)-2-(4-Nitrophenyl)Ethane |
|---|---|
| Synonyms | 1-(4-Butyrylphenyl)-2-(4-Nitrophenyl)Ethane |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 |
| CAS Registry Number | 17302-70-4 |
| SMILES | C1=C(C(=O)CCC)C=CC(=C1)CCC2=CC=C([N+]([O-])=O)C=C2 |
| InChI | 1S/C18H19NO3/c1-2-3-18(20)16-10-6-14(7-11-16)4-5-15-8-12-17(13-9-15)19(21)22/h6-13H,2-5H2,1H3 |
| InChIKey | HQXSMDGREYUOEZ-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.607°C at 760 mmHg (Cal.) |
| Flash point | 201.878°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Butyrylphenyl)-2-(4-Nitrophenyl)Ethane |