|
CAS#: 17318-24-0 Product: 3',5'-Di-O-Acetyl-2'-Deoxyadenosine No suppilers available for the product. |
| Name | 3',5'-Di-O-Acetyl-2'-Deoxyadenosine |
|---|---|
| Synonyms | [2-(Acetoxymethyl)-5-(6-Aminopurin-9-Yl)Tetrahydrofuran-3-Yl] Acetate; Acetic Acid [2-(Acetoxymethyl)-5-(6-Amino-9-Purinyl)-3-Tetrahydrofuranyl] Ester; Acetic Acid [2-(Acetoxymethyl)-5-(6-Aminopurin-9-Yl)Tetrahydrofuran-3-Yl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N5O5 |
| Molecular Weight | 335.32 |
| CAS Registry Number | 17318-24-0 |
| SMILES | C1=NC3=C([N]1C2CC(OC(C)=O)C(O2)COC(C)=O)N=CN=C3N |
| InChI | 1S/C14H17N5O5/c1-7(20)22-4-10-9(23-8(2)21)3-11(24-10)19-6-18-12-13(15)16-5-17-14(12)19/h5-6,9-11H,3-4H2,1-2H3,(H2,15,16,17) |
| InChIKey | SKDMUZGQFAEWOS-UHFFFAOYSA-N |
| Density | 1.624g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.139°C at 760 mmHg (Cal.) |
| Flash point | 290.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',5'-Di-O-Acetyl-2'-Deoxyadenosine |