|
CAS#: 173908-45-7 Product: 5-Chloro-2-Indol-1-Ylsulfonylaniline No suppilers available for the product. |
| Name | 5-Chloro-2-Indol-1-Ylsulfonylaniline |
|---|---|
| Synonyms | 5-Chloro-2-Indol-1-Ylsulfonyl-Aniline; 5-Chloro-2-(1-Indolylsulfonyl)Aniline; (5-Chloro-2-Indol-1-Ylsulfonyl-Phenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClN2O2S |
| Molecular Weight | 306.77 |
| CAS Registry Number | 173908-45-7 |
| SMILES | C1=CC3=C([N]1[S](C2=CC=C(C=C2N)Cl)(=O)=O)C=CC=C3 |
| InChI | 1S/C14H11ClN2O2S/c15-11-5-6-14(12(16)9-11)20(18,19)17-8-7-10-3-1-2-4-13(10)17/h1-9H,16H2 |
| InChIKey | XOBHXKZNUDOUNR-UHFFFAOYSA-N |
| Density | 1.463g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.053°C at 760 mmHg (Cal.) |
| Flash point | 276.181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-Indol-1-Ylsulfonylaniline |