Online Database of Chemicals from Around the World
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (386) 462-0788 | |||
 |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 1,3,3,4,4,5,5-Heptafluoro-2-Methoxy-1-Cyclopentene |
|---|---|
| Synonyms | 1,3,3,4,4,5,5-Heptafluoro-2-Methoxy-Cyclopentene; Monomethoxyheptafluorocyclopentene; Brn 1820458 |
| Molecular Structure |  |
| Molecular Formula | C6H3F7O |
| Molecular Weight | 224.08 |
| CAS Registry Number | 1759-60-0 |
| SMILES | COC1=C(C(C(C1(F)F)(F)F)(F)F)F |
| InChI | 1S/C6H3F7O/c1-14-3-2(7)4(8,9)6(12,13)5(3,10)11/h1H3 |
| InChIKey | HCVGDVYOISIYKY-UHFFFAOYSA-N |
| Density | 1.529g/cm3 (Cal.) |
|---|---|
| Boiling point | 102.656°C at 760 mmHg (Cal.) |
| Flash point | 21.317°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,3,4,4,5,5-Heptafluoro-2-Methoxy-1-Cyclopentene |