|
CAS#: 17601-12-6 Product: Bis(4-Phenoxyphenyl)Diphenylstannane No suppilers available for the product. |
| Name | Bis(4-Phenoxyphenyl)Diphenylstannane |
|---|---|
| Synonyms | Nsc 220106; Tin, Bis(P-Phenoxyphenyl)Diphenyl- (7Ci); Bis(P-Phenoxyphenyl)Diphenyltin |
| Molecular Structure | ![]() |
| Molecular Formula | C36H28O2Sn |
| Molecular Weight | 611.31 |
| CAS Registry Number | 17601-12-6 |
| SMILES | C1=CC(=CC=C1[Sn](C3=CC=C(OC2=CC=CC=C2)C=C3)(C4=CC=CC=C4)C5=CC=CC=C5)OC6=CC=CC=C6 |
| InChI | 1S/2C12H9O.2C6H5.Sn/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-2-4-6-5-3-1;/h2*1,3-10H;2*1-5H; |
| InChIKey | WLCKHJKBWHUTKD-UHFFFAOYSA-N |
| Boiling point | 635.23°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 337.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Phenoxyphenyl)Diphenylstannane |