Online Database of Chemicals from Around the World
|
CAS#: 17601-86-4 Product: 2-Phenyl-3-[(2,4,5-Trichlorophenyl)Azo]Indole No suppilers available for the product. |
| Name | 2-Phenyl-3-[(2,4,5-Trichlorophenyl)Azo]Indole |
|---|---|
| Synonyms | 2,4,5-Trichloro-N-[(2-Phenyl-3-Indolylidene)Amino]Aniline; [(2-Phenylindol-3-Ylidene)Amino]-(2,4,5-Trichlorophenyl)Amine; 2-Phenyl-3-((2,4,5-Trichlorophenyl)Azo)-1H-Indole |
| Molecular Structure | ![CAS#: 17601-86-4, 2-Phenyl-3-[(2,4,5-Trichlorophenyl)Azo]Indole](/moreStructures/17601-86-4.gif) |
| Molecular Formula | C20H12Cl3N3 |
| Molecular Weight | 400.69 |
| CAS Registry Number | 17601-86-4 |
| EINECS | 241-573-9 |
| SMILES | C3=C2C(=N/NC1=CC(=C(Cl)C=C1Cl)Cl)\C(=NC2=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C20H12Cl3N3/c21-14-10-16(23)18(11-15(14)22)25-26-20-13-8-4-5-9-17(13)24-19(20)12-6-2-1-3-7-12/h1-11,25H/b26-20+ |
| InChIKey | BROWXBQFNZCGPD-LHLOQNFPSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.793°C at 760 mmHg (Cal.) |
| Flash point | 277.838°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-3-[(2,4,5-Trichlorophenyl)Azo]Indole |