|
CAS#: 1776-70-1 Product: Arsenotrithious Acid Triphenyl Ester No suppilers available for the product. |
| Name | Arsenotrithious Acid Triphenyl Ester |
|---|---|
| Synonyms | Tris(Phenylthio)Arsane; Arsenotrithious Acid, Triphenyl Ester; Thioarsenious Acid (H3ass3), Triphenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15AsS3 |
| Molecular Weight | 402.42 |
| CAS Registry Number | 1776-70-1 |
| SMILES | C3=C(S[As](SC1=CC=CC=C1)SC2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C18H15AsS3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H |
| InChIKey | GSDQLEGNNAMRJO-UHFFFAOYSA-N |
| Boiling point | 510.33°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 268.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Arsenotrithious Acid Triphenyl Ester |