|
CAS#: 17760-93-9 Product: Polychlorinatedterphenyls No suppilers available for the product. |
| Name | Polychlorinatedterphenyls |
|---|---|
| Synonyms | Cyclopenta(Cd)Pentalene, 1,2,2A,3,4,4A,5,6,6A,6B-Decachloro-2A,4A,6A,6B-Tetrahydro-; Polychlorinated Triphenyls |
| Molecular Formula | C18H8Cl6 |
| Molecular Weight | 436.98 |
| CAS Registry Number | 17760-93-9 |
| SMILES | C1=C(C(=CC(=C1C2=CC=C(C=C2Cl)Cl)Cl)C3=CC(=C(C=C3)Cl)Cl)Cl |
| InChI | 1S/C18H8Cl6/c19-10-2-3-11(15(21)6-10)13-8-16(22)12(7-17(13)23)9-1-4-14(20)18(24)5-9/h1-8H |
| InChIKey | MKMRJVXZNDEBOU-UHFFFAOYSA-N |
| Density | 1.498g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.842°C at 760 mmHg (Cal.) |
| Flash point | 253.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Polychlorinatedterphenyls |