|
CAS#: 1786-87-4 Product: Dioxyisophthalic Acid No suppilers available for the product. |
| Name | Dioxyisophthalic Acid |
|---|---|
| Synonyms | Peroxyisophthalic Acid; 1,3-Benzenedicarboperoxoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 1786-87-4 |
| EINECS | 217-245-6 |
| SMILES | C1=CC(=CC(=C1)C(=O)OO)C(=O)OO |
| InChI | 1S/C8H6O6/c9-7(13-11)5-2-1-3-6(4-5)8(10)14-12/h1-4,11-12H |
| InChIKey | KXEMXOYVVPLGSD-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.249°C at 760 mmHg (Cal.) |
| Flash point | 185.526°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dioxyisophthalic Acid |