|
CAS#: 17969-45-8 Product: Brofezil No suppilers available for the product. |
| Name | Brofezil |
|---|---|
| Synonyms | 2-[4-(4-Bromophenyl)Thiazol-2-Yl]Propanoic Acid; 2-[4-(4-Bromophenyl)-2-Thiazolyl]Propanoic Acid; 2-[4-(4-Bromophenyl)Thiazol-2-Yl]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10BrNO2S |
| Molecular Weight | 312.18 |
| CAS Registry Number | 17969-45-8 |
| SMILES | C2=C(C1=CC=C(C=C1)Br)N=C(C(C(O)=O)C)S2 |
| InChI | 1S/C12H10BrNO2S/c1-7(12(15)16)11-14-10(6-17-11)8-2-4-9(13)5-3-8/h2-7H,1H3,(H,15,16) |
| InChIKey | JGQKYWPSFPCKLW-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.784°C at 760 mmHg (Cal.) |
| Flash point | 231.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Brofezil |