|
CAS#: 180301-45-5 Product: 3-(3,7-Dimethyl-2,6-Dioxopurin-1-Yl)Propyl Diethylaminomethanedithioate No suppilers available for the product. |
| Name | 3-(3,7-Dimethyl-2,6-Dioxopurin-1-Yl)Propyl Diethylaminomethanedithioate |
|---|---|
| Synonyms | 3-(3,7-Dimethyl-2,6-Dioxo-Purin-1-Yl)Propyl Diethylaminomethanedithioate; Diethylaminomethanedithioic Acid 3-(3,7-Dimethyl-2,6-Dioxo-1-Purinyl)Propyl Ester; Diethylaminomethanedithioic Acid 3-(2,6-Diketo-3,7-Dimethyl-Purin-1-Yl)Propyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23N5O2S2 |
| Molecular Weight | 369.50 |
| CAS Registry Number | 180301-45-5 |
| SMILES | C1=NC2=C([N]1C)C(N(CCCSC(N(CC)CC)=S)C(N2C)=O)=O |
| InChI | 1S/C15H23N5O2S2/c1-5-19(6-2)15(23)24-9-7-8-20-13(21)11-12(16-10-17(11)3)18(4)14(20)22/h10H,5-9H2,1-4H3 |
| InChIKey | IMUGRQWAPATDDH-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.952°C at 760 mmHg (Cal.) |
| Flash point | 296.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,7-Dimethyl-2,6-Dioxopurin-1-Yl)Propyl Diethylaminomethanedithioate |