|
CAS#: 181145-46-0 Product: 9-Dimethyl-2H-Pyrazolo(3,4-c)(2,1)Benzothiazepin-4(9H)-One O-(2-(Dimethylamino)Ethyl)Oxime 10,10-Dioxide (Z)-2-Butenedioate (1:1) No suppilers available for the product. |
| Name | 9-Dimethyl-2H-Pyrazolo(3,4-c)(2,1)Benzothiazepin-4(9H)-One O-(2-(Dimethylamino)Ethyl)Oxime 10,10-Dioxide (Z)-2-Butenedioate (1:1) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H25N5O7S |
| Molecular Weight | 479.51 |
| CAS Registry Number | 181145-46-0 |
| SMILES | C1=C/2C(=N[N]1C)[S](=O)(=O)N(C3=C(C2=N/OCCN(C)C)C=CC=C3)C.O=C(O)\C=C\C(=O)O |
| InChI | 1S/C16H21N5O3S.C4H4O4/c1-19(2)9-10-24-18-15-12-7-5-6-8-14(12)21(4)25(22,23)16-13(15)11-20(3)17-16;5-3(6)1-2-4(7)8/h5-8,11H,9-10H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b18-15+;2-1+ |
| InChIKey | LWSSFLKRWAEYNY-FVEGSWOLSA-N |
| Boiling point | 521.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 269.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Dimethyl-2H-Pyrazolo(3,4-c)(2,1)Benzothiazepin-4(9H)-One O-(2-(Dimethylamino)Ethyl)Oxime 10,10-Dioxide (Z)-2-Butenedioate (1:1) |