|
CAS#: 18264-84-1 Product: 2-Bromo-3-Nitro-9,10-Dihydrophenanthrene No suppilers available for the product. |
| Name | 2-Bromo-3-Nitro-9,10-Dihydrophenanthrene |
|---|---|
| Synonyms | 2-Bromo-3-nitro-9,10-dihydrophenanthrene # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10BrNO2 |
| Molecular Weight | 304.14 |
| CAS Registry Number | 18264-84-1 |
| SMILES | [O-][N+](=O)c3c(Br)cc2c(c1c(cccc1)CC2)c3 |
| InChI | 1S/C14H10BrNO2/c15-13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14(13)16(17)18/h1-4,7-8H,5-6H2 |
| InChIKey | AQOOEEUCWGIPOO-UHFFFAOYSA-N |
| Density | 1.567g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.96°C at 760 mmHg (Cal.) |
| Flash point | 201.737°C (Cal.) |
| Refractive index | 1.672 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-3-Nitro-9,10-Dihydrophenanthrene |