Online Database of Chemicals from Around the World
|
CAS#: 18429-71-5 Product: 4,5,10-Trimethylbenz[a]Anthracene No suppilers available for the product. |
| Name | 4,5,10-Trimethylbenz[a]Anthracene |
|---|---|
| Synonyms | 4,5,10-Trimethylbenz(A)Anthracene; Benz(A)Anthracene, 4,5,10-Trimethyl- |
| Molecular Structure | ![CAS#: 18429-71-5, 4,5,10-Trimethylbenz[a]Anthracene](/moreStructures/18429-71-5.gif) |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 18429-71-5 |
| SMILES | C2=C1C4=C(C(=CC1=CC3=CC=C(C=C23)C)C)C(=CC=C4)C |
| InChI | 1S/C21H18/c1-13-7-8-16-11-18-10-15(3)21-14(2)5-4-6-19(21)20(18)12-17(16)9-13/h4-12H,1-3H3 |
| InChIKey | BABWOXAQJTZWJJ-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.758°C at 760 mmHg (Cal.) |
| Flash point | 238.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,10-Trimethylbenz[a]Anthracene |