|
CAS#: 1885-98-9 Product: Phosphorothioic Acid O,O-Diethyl S-(1,2,2-Trichloroethyl) Ester No suppilers available for the product. |
| Name | Phosphorothioic Acid O,O-Diethyl S-(1,2,2-Trichloroethyl) Ester |
|---|---|
| Synonyms | 1-[Ethoxy-(1,2,2-Trichloroethylthio)Phosphoryl]Oxyethane; Ai3-27283; Brn 2099814 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12Cl3O3PS |
| Molecular Weight | 301.55 |
| CAS Registry Number | 1885-98-9 |
| SMILES | C(O[P](SC(C(Cl)Cl)Cl)(=O)OCC)C |
| InChI | 1S/C6H12Cl3O3PS/c1-3-11-13(10,12-4-2)14-6(9)5(7)8/h5-6H,3-4H2,1-2H3 |
| InChIKey | HGDGWEKDDGPTFH-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.727°C at 760 mmHg (Cal.) |
| Flash point | 130.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphorothioic Acid O,O-Diethyl S-(1,2,2-Trichloroethyl) Ester |