Online Database of Chemicals from Around the World
|
CAS#: 18864-28-3 Product: 5-Amino-1,1-Dimethylhexyl Dihydrogen Phosphate No suppilers available for the product. |
| Name | 5-Amino-1,1-Dimethylhexyl Dihydrogen Phosphate |
|---|---|
| Synonyms | (5-Amino-1,1-Dimethyl-Hexyl) Dihydrogen Phosphate; (5-Amino-1,1-Dimethylhexyl) Dihydrogen Phosphate; (6-Amino-2-Methyl-Heptan-2-Yl) Dihydrogen Phosphate |
| Molecular Structure |  |
| Molecular Formula | C8H20NO4P |
| Molecular Weight | 225.22 |
| CAS Registry Number | 18864-28-3 |
| EINECS | 242-635-8 |
| SMILES | C(CC(C)(C)O[P](=O)(O)O)CC(N)C |
| InChI | 1S/C8H20NO4P/c1-7(9)5-4-6-8(2,3)13-14(10,11)12/h7H,4-6,9H2,1-3H3,(H2,10,11,12) |
| InChIKey | JUFGOWAGSGRBGQ-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.398°C at 760 mmHg (Cal.) |
| Flash point | 173.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-1,1-Dimethylhexyl Dihydrogen Phosphate |