|
CAS#: 19134-31-7 Product: 5-Chloro-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole No suppilers available for the product. |
| Name | 5-Chloro-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |
|---|---|
| Synonyms | 5-Chloro-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole; 5-Chloro-3-(1-Methyl-2-Pyrrolidinyl)Indole; Brn 0524760 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 |
| CAS Registry Number | 19134-31-7 |
| SMILES | C1=C(C2=C([NH]1)C=CC(=C2)Cl)C3N(CCC3)C |
| InChI | 1S/C13H15ClN2/c1-16-6-2-3-13(16)11-8-15-12-5-4-9(14)7-10(11)12/h4-5,7-8,13,15H,2-3,6H2,1H3 |
| InChIKey | KSVBDCVNOLOLNW-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.8°C at 760 mmHg (Cal.) |
| Flash point | 184.706°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |