|
CAS#: 19137-61-2 Product: 1-Methyl-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole No suppilers available for the product. |
| Name | 1-Methyl-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |
|---|---|
| Synonyms | 1-Methyl-3-(1-Methyl-2-Pyrrolidinyl)Indole; Brn 0612142; Indole, 1-Methyl-3-(1-Methyl-2-Pyrrolidinyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 |
| CAS Registry Number | 19137-61-2 |
| SMILES | C1=C(C2=C([N]1C)C=CC=C2)C3N(CCC3)C |
| InChI | 1S/C14H18N2/c1-15-9-5-8-14(15)12-10-16(2)13-7-4-3-6-11(12)13/h3-4,6-7,10,14H,5,8-9H2,1-2H3 |
| InChIKey | ONASFMNNONUTBN-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.086°C at 760 mmHg (Cal.) |
| Flash point | 162.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |