|
CAS#: 1923-01-9 Product: Trimethyl-(1-Phenylethenyl)Silane No suppilers available for the product. |
| Name | Trimethyl-(1-Phenylethenyl)Silane |
|---|---|
| Synonyms | Trimethyl-(1-Phenylvinyl)Silane; Silane, Trimethyl(1-Phenylethenyl)-; Silane,Trimethyl(1-Phenylethenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16Si |
| Molecular Weight | 176.33 |
| CAS Registry Number | 1923-01-9 |
| SMILES | C1=C(C([Si](C)(C)C)=C)C=CC=C1 |
| InChI | 1S/C11H16Si/c1-10(12(2,3)4)11-8-6-5-7-9-11/h5-9H,1H2,2-4H3 |
| InChIKey | WNAGIMQWCVOKKX-UHFFFAOYSA-N |
| Density | 0.864g/cm3 (Cal.) |
|---|---|
| Boiling point | 217.025°C at 760 mmHg (Cal.) |
| Flash point | 70.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl-(1-Phenylethenyl)Silane |