|
CAS#: 1945-67-1 Product: Dimethylglyoxal Bis(Guanylhydrazone) No suppilers available for the product. |
| Name | Dimethylglyoxal Bis(Guanylhydrazone) |
|---|---|
| Synonyms | Acetic Acid; 2-[[(2E)-2-(Diaminomethylenehydrazono)-1-Methyl-Propylidene]Amino]Guanidine; Acetic Acid; 2-[[(2E)-2-(Diaminomethylenehydrazono)-1-Methylpropylidene]Amino]Guanidine; 2-[[(3E)-3-(Diaminomethylidenehydrazinylidene)Butan-2-Ylidene]Amino]Guanidine; Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18N8O2 |
| Molecular Weight | 258.28 |
| CAS Registry Number | 1945-67-1 |
| SMILES | CC(O)=O.CC(=N/N=C(N)N)\C(=N\N=C(N)N)C |
| InChI | 1S/C6H14N8.C2H4O2/c1-3(11-13-5(7)8)4(2)12-14-6(9)10;1-2(3)4/h1-2H3,(H4,7,8,13)(H4,9,10,14);1H3,(H,3,4)/b11-3+,12-4+; |
| InChIKey | RHALGVPCVOQQAP-FLVPNXLJSA-N |
| Boiling point | 432.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 215.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethylglyoxal Bis(Guanylhydrazone) |