|
CAS#: 19480-39-8 Product: Ammonium 4-Chloro-2-Methylphenoxyacetate No suppilers available for the product. |
| Name | Ammonium 4-Chloro-2-Methylphenoxyacetate |
|---|---|
| Synonyms | Ammonium 2-(4-Chloro-2-Methyl-Phenoxy)Acetate; Ammonium 2-(4-Chloro-2-Methylphenoxy)Acetate; Azanium 2-(4-Chloro-2-Methyl-Phenoxy)Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 |
| CAS Registry Number | 19480-39-8 |
| EINECS | 243-101-7 |
| SMILES | C1=C(Cl)C=CC(=C1C)OCC([O-])=O.[NH4+] |
| InChI | 1S/C9H9ClO3.H3N/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);1H3 |
| InChIKey | PMPOPSWETLDYSC-UHFFFAOYSA-N |
| Boiling point | 327°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 4-Chloro-2-Methylphenoxyacetate |