|
CAS#: 19555-64-7 Product: 10-(2-Chloroethyl)-3-Methoxy-Phenothiazine No suppilers available for the product. |
| Name | 10-(2-Chloroethyl)-3-Methoxy-Phenothiazine |
|---|---|
| Synonyms | 10-(2-Chloroethyl)-3-Methoxy-Phenothiazine; Nsc66376; Nciopen2_003199 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14ClNOS |
| Molecular Weight | 291.79 |
| CAS Registry Number | 19555-64-7 |
| SMILES | C1=CC(=CC3=C1N(C2=C(C=CC=C2)S3)CCCl)OC |
| InChI | 1S/C15H14ClNOS/c1-18-11-6-7-13-15(10-11)19-14-5-3-2-4-12(14)17(13)9-8-16/h2-7,10H,8-9H2,1H3 |
| InChIKey | RZYVFXOPTABIAV-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.173°C at 760 mmHg (Cal.) |
| Flash point | 226.057°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-(2-Chloroethyl)-3-Methoxy-Phenothiazine |